C15H13FN4O3 — CID 168908064
N-[(E)-[2-fluoro-4-(hydroxycarbamoyl)phenyl]methylideneamino]-N-methylpyridine-3-carboxamide (PubChem CID 168908064) has the molecular formula C15H13FN4O3 and a molecular weight of 316.29 g/mol. Its IUPAC name is N-[(E)-[2-fluoro-4-(hydroxycarbamoyl)phenyl]methylideneamino]-N-methylpyridine-3-carboxamide.
| Compound Name | N-[(E)-[2-fluoro-4-(hydroxycarbamoyl)phenyl]methylideneamino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 168908064 |
| Molecular Formula | C15H13FN4O3 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[(E)-[2-fluoro-4-(hydroxycarbamoyl)phenyl]methylideneamino]-N-methylpyridine-3-carboxamide |
| SMILES | CN(/N=C/c1ccc(C(=O)NO)cc1F)C(=O)c1cccnc1 |
| InChI | InChI=1S/C15H13FN4O3/c1-20(15(22)12-3-2-6-17-8-12)18-9-11-5-4-10(7-13(11)16)14(21)19-23/h2-9,23H,1H3,(H,19,21)/b18-9+ |
| InChIKey | MCCOOOINKGYOGO-GIJQJNRQSA-N |
| XLogP | 1.45 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|