C28H32N2O4 — CID 168908373
10-(2-phenylethylcarbamoyloxy)deca-4,6-diynyl N-(2-phenylethyl)carbamate (PubChem CID 168908373) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 10-(2-phenylethylcarbamoyloxy)deca-4,6-diynyl N-(2-phenylethyl)carbamate.
| Compound Name | 10-(2-phenylethylcarbamoyloxy)deca-4,6-diynyl N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 168908373 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 10-(2-phenylethylcarbamoyloxy)deca-4,6-diynyl N-(2-phenylethyl)carbamate |
| SMILES | O=C(NCCc1ccccc1)OCCCC#CC#CCCCOC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C28H32N2O4/c31-27(29-21-19-25-15-9-7-10-16-25)33-23-13-5-3-1-2-4-6-14-24-34-28(32)30-22-20-26-17-11-8-12-18-26/h7-12,15-18H,5-6,13-14,19-24H2,(H,29,31)(H,30,32) |
| InChIKey | PYTFDRBRYNLILW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|