C17H20BrNO4 — CID 135074599
3-(phenylmethoxycarbonylamino)propyl 6-bromohex-5-ynoate (PubChem CID 135074599) has the molecular formula C17H20BrNO4 and a molecular weight of 382.25 g/mol. Its IUPAC name is 3-(phenylmethoxycarbonylamino)propyl 6-bromohex-5-ynoate.
| Compound Name | 3-(phenylmethoxycarbonylamino)propyl 6-bromohex-5-ynoate |
|---|---|
| PubChem CID | 135074599 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 3-(phenylmethoxycarbonylamino)propyl 6-bromohex-5-ynoate |
| SMILES | O=C(CCCC#CBr)OCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20BrNO4/c18-11-6-2-5-10-16(20)22-13-7-12-19-17(21)23-14-15-8-3-1-4-9-15/h1,3-4,8-9H,2,5,7,10,12-14H2,(H,19,21) |
| InChIKey | IBVIYWBVFHOVOQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|