C15H16BrNO4 — CID 135074598
2-(phenylmethoxycarbonylamino)ethyl 5-bromopent-4-ynoate (PubChem CID 135074598) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-(phenylmethoxycarbonylamino)ethyl 5-bromopent-4-ynoate.
| Compound Name | 2-(phenylmethoxycarbonylamino)ethyl 5-bromopent-4-ynoate |
|---|---|
| PubChem CID | 135074598 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-(phenylmethoxycarbonylamino)ethyl 5-bromopent-4-ynoate |
| SMILES | O=C(CCC#CBr)OCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H16BrNO4/c16-9-5-4-8-14(18)20-11-10-17-15(19)21-12-13-6-2-1-3-7-13/h1-3,6-7H,4,8,10-12H2,(H,17,19) |
| InChIKey | WJJOIQIKFJSNDS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|