C20H23ClN4OS — CID 168910272
(4S)-4-[(1Z,4E,5Z)-1-amino-4-(chloromethylimino)-6-(methylideneamino)-3-oxo-2-propylhexa-1,5-dienyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 168910272) has the molecular formula C20H23ClN4OS and a molecular weight of 402.95 g/mol. Its IUPAC name is (4S)-4-[(1Z,4E,5Z)-1-amino-4-(chloromethylimino)-6-(methylideneamino)-3-oxo-2-propylhexa-1,5-dienyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (4S)-4-[(1Z,4E,5Z)-1-amino-4-(chloromethylimino)-6-(methylideneamino)-3-oxo-2-propylhexa-1,5-dienyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 168910272 |
| Molecular Formula | C20H23ClN4OS |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (4S)-4-[(1Z,4E,5Z)-1-amino-4-(chloromethylimino)-6-(methylideneamino)-3-oxo-2-propylhexa-1,5-dienyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | C=N/C=C\C(=N/CCl)C(=O)/C(CCC)=C(\N)[C@H]1CCCc2scc(C#N)c21 |
| InChI | InChI=1S/C20H23ClN4OS/c1-3-5-15(20(26)16(25-12-21)8-9-24-2)19(23)14-6-4-7-17-18(14)13(10-22)11-27-17/h8-9,11,14H,2-7,12,23H2,1H3/b9-8-,19-15-,25-16+/t14-/m0/s1 |
| InChIKey | ZGFSQXZUFLFEOM-IXCGPHCNSA-N |
| XLogP | 4.47 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|