C40H47N11O5 — CID 168911796
2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-[4-[[7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione (PubChem CID 168911796) has the molecular formula C40H47N11O5 and a molecular weight of 761.89 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-[4-[[7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-[4-[[7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168911796 |
| Molecular Formula | C40H47N11O5 |
| Molecular Weight | 761.89 g/mol |
| Exact Mass | 761.38 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-[4-[[7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione |
| SMILES | Cn1cc(-c2ccc3cnc(Nc4cnn(C5CCN(CCCCCCCCCOc6cccc7c6C(=O)N(C6CCC(=O)NC6=O)C7=O)CC5)c4)nn23)cn1 |
| InChI | InChI=1S/C40H47N11O5/c1-47-25-27(22-42-47)32-13-12-30-24-41-40(46-51(30)32)44-28-23-43-49(26-28)29-16-19-48(20-17-29)18-7-5-3-2-4-6-8-21-56-34-11-9-10-31-36(34)39(55)50(38(31)54)33-14-15-35(52)45-37(33)53/h9-13,22-26,29,33H,2-8,14-21H2,1H3,(H,44,46)(H,45,52,53) |
| InChIKey | KCBPHXYYCCBCLC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|