C30H38N6O7 — CID 168911822
2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-(4-nitropyrazol-1-yl)piperidin-1-yl]nonoxy]isoindole-1,3-dione (PubChem CID 168911822) has the molecular formula C30H38N6O7 and a molecular weight of 594.67 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-(4-nitropyrazol-1-yl)piperidin-1-yl]nonoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-(4-nitropyrazol-1-yl)piperidin-1-yl]nonoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168911822 |
| Molecular Formula | C30H38N6O7 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[9-[4-(4-nitropyrazol-1-yl)piperidin-1-yl]nonoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCCCCCCCCCN4CCC(n5cc([N+](=O)[O-])cn5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H38N6O7/c37-26-12-11-24(28(38)32-26)35-29(39)23-9-8-10-25(27(23)30(35)40)43-18-7-5-3-1-2-4-6-15-33-16-13-21(14-17-33)34-20-22(19-31-34)36(41)42/h8-10,19-21,24H,1-7,11-18H2,(H,32,37,38) |
| InChIKey | OXCAIJUVYMLAIR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 156.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|