About 2,2-dimethyloxane;ethene
2,2-dimethyloxane;ethene (PubChem CID 168913071) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2,2-dimethyloxane;ethene.
Molecular Properties
| Compound Name | 2,2-dimethyloxane;ethene |
| PubChem CID | 168913071 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2,2-dimethyloxane;ethene |
| SMILES | C=C.CC1(C)CCCCO1 |
| InChI | InChI=1S/C7H14O.C2H4/c1-7(2)5-3-4-6-8-7;1-2/h3-6H2,1-2H3;1-2H2 |
| InChIKey | DTUZHUPHIXWPSU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxane;ethene?
The IUPAC name of 2,2-dimethyloxane;ethene (CID 168913071) is 2,2-dimethyloxane;ethene.
What is the SMILES notation for 2,2-dimethyloxane;ethene?
The canonical SMILES for 2,2-dimethyloxane;ethene is C=C.CC1(C)CCCCO1.
What is the InChIKey of 2,2-dimethyloxane;ethene?
The InChIKey is DTUZHUPHIXWPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C2H4/c1-7(2)5-3-4-6-8-7;1-2/h3-6H2,1-2H3;1-2H2.
What are the key properties of 2,2-dimethyloxane;ethene?
2,2-dimethyloxane;ethene has a molecular weight of 142.24 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxane;ethene is sourced from PubChem (CID 168913071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).