C21H23N7O3 — CID 168914067
2-amino-4-methoxypyrimidine-5-carbonitrile;N-(3-piperidin-1-yl-1,2-benzoxazol-7-yl)prop-2-enamide (PubChem CID 168914067) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-amino-4-methoxypyrimidine-5-carbonitrile;N-(3-piperidin-1-yl-1,2-benzoxazol-7-yl)prop-2-enamide.
| Compound Name | 2-amino-4-methoxypyrimidine-5-carbonitrile;N-(3-piperidin-1-yl-1,2-benzoxazol-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 168914067 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-amino-4-methoxypyrimidine-5-carbonitrile;N-(3-piperidin-1-yl-1,2-benzoxazol-7-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc2c(N3CCCCC3)noc12.COc1nc(N)ncc1C#N |
| InChI | InChI=1S/C15H17N3O2.C6H6N4O/c1-2-13(19)16-12-8-6-7-11-14(12)20-17-15(11)18-9-4-3-5-10-18;1-11-5-4(2-7)3-9-6(8)10-5/h2,6-8H,1,3-5,9-10H2,(H,16,19);3H,1H3,(H2,8,9,10) |
| InChIKey | IBDLVNPLCYLJIO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|