C8H13NOS2 — CID 168914424
(NE)-N-[1-(2-cyclopropyl-1,3-dithiolan-2-yl)ethylidene]hydroxylamine (PubChem CID 168914424) has the molecular formula C8H13NOS2 and a molecular weight of 203.33 g/mol. Its IUPAC name is (NE)-N-[1-(2-cyclopropyl-1,3-dithiolan-2-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2-cyclopropyl-1,3-dithiolan-2-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 168914424 |
| Molecular Formula | C8H13NOS2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | (NE)-N-[1-(2-cyclopropyl-1,3-dithiolan-2-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)C1(C2CC2)SCCS1 |
| InChI | InChI=1S/C8H13NOS2/c1-6(9-10)8(7-2-3-7)11-4-5-12-8/h7,10H,2-5H2,1H3/b9-6+ |
| InChIKey | OPBKROWQWQKFNS-RMKNXTFCSA-N |
| XLogP | 2.42 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|