C8H15NOS — CID 172981190
(NE)-N-[1-(4,5-dimethylthiolan-2-yl)ethylidene]hydroxylamine (PubChem CID 172981190) has the molecular formula C8H15NOS and a molecular weight of 173.28 g/mol. Its IUPAC name is (NE)-N-[1-(4,5-dimethylthiolan-2-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(4,5-dimethylthiolan-2-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 172981190 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | (NE)-N-[1-(4,5-dimethylthiolan-2-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)C1CC(C)C(C)S1 |
| InChI | InChI=1S/C8H15NOS/c1-5-4-8(6(2)9-10)11-7(5)3/h5,7-8,10H,4H2,1-3H3/b9-6+ |
| InChIKey | HZZRAXWPCDPFJP-RMKNXTFCSA-N |
| XLogP | 2.37 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|