C9H17NOS — CID 2833960
N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine (PubChem CID 2833960) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine.
| Compound Name | N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 2833960 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine |
| SMILES | CCC1SC(C)CC(=NO)C1C |
| InChI | InChI=1S/C9H17NOS/c1-4-9-7(3)8(10-11)5-6(2)12-9/h6-7,9,11H,4-5H2,1-3H3 |
| InChIKey | YHVCTXUGBPVHTM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|