C10H19NOS2 — CID 10059899
(NZ)-N-[4-methyl-1-(2-methyl-1,3-dithiolan-2-yl)pentan-3-ylidene]hydroxylamine (PubChem CID 10059899) has the molecular formula C10H19NOS2 and a molecular weight of 233.40 g/mol. Its IUPAC name is (NZ)-N-[4-methyl-1-(2-methyl-1,3-dithiolan-2-yl)pentan-3-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[4-methyl-1-(2-methyl-1,3-dithiolan-2-yl)pentan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 10059899 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (NZ)-N-[4-methyl-1-(2-methyl-1,3-dithiolan-2-yl)pentan-3-ylidene]hydroxylamine |
| SMILES | CC(C)/C(CCC1(C)SCCS1)=N\O |
| InChI | InChI=1S/C10H19NOS2/c1-8(2)9(11-12)4-5-10(3)13-6-7-14-10/h8,12H,4-7H2,1-3H3/b11-9- |
| InChIKey | IBOCBHVMCYYXKN-LUAWRHEFSA-N |
| XLogP | 3.45 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|