C36H43NO — CID 168915013
ethane;17-methyl-8-methylidene-2-[(E)-1-(2-methylpropylideneamino)prop-1-en-2-yl]-6-[(Z)-prop-1-enyl]tetracyclo[14.3.1.13,7.19,13]docosa-1(20),3(22),4,6,9,11,13(21),16,18-nonaen-2-ol (PubChem CID 168915013) has the molecular formula C36H43NO and a molecular weight of 505.75 g/mol. Its IUPAC name is ethane;17-methyl-8-methylidene-2-[(E)-1-(2-methylpropylideneamino)prop-1-en-2-yl]-6-[(Z)-prop-1-enyl]tetracyclo[14.3.1.13,7.19,13]docosa-1(20),3(22),4,6,9,11,13(21),16,18-nonaen-2-ol.
| Compound Name | ethane;17-methyl-8-methylidene-2-[(E)-1-(2-methylpropylideneamino)prop-1-en-2-yl]-6-[(Z)-prop-1-enyl]tetracyclo[14.3.1.13,7.19,13]docosa-1(20),3(22),4,6,9,11,13(21),16,18-nonaen-2-ol |
|---|---|
| PubChem CID | 168915013 |
| Molecular Formula | C36H43NO |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | ethane;17-methyl-8-methylidene-2-[(E)-1-(2-methylpropylideneamino)prop-1-en-2-yl]-6-[(Z)-prop-1-enyl]tetracyclo[14.3.1.13,7.19,13]docosa-1(20),3(22),4,6,9,11,13(21),16,18-nonaen-2-ol |
| SMILES | C=C1c2cccc(c2)CCc2cc(ccc2C)C(O)(/C(C)=C/N=C/C(C)C)c2ccc(/C=C\C)c1c2.CC |
| InChI | InChI=1S/C34H37NO.C2H6/c1-7-9-28-15-17-32-20-33(28)26(6)30-11-8-10-27(18-30)13-14-29-19-31(16-12-24(29)4)34(32,36)25(5)22-35-21-23(2)3;1-2/h7-12,15-23,36H,6,13-14H2,1-5H3;1-2H3/b9-7-,25-22+,35-21+; |
| InChIKey | FDODSIYKLXNYLJ-IRDVGBJHSA-N |
| XLogP | 9.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|