C17H19NO — CID 162413586
3-ethylimino-1,1-diphenylpropan-1-ol (PubChem CID 162413586) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-ethylimino-1,1-diphenylpropan-1-ol.
| Compound Name | 3-ethylimino-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 162413586 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-ethylimino-1,1-diphenylpropan-1-ol |
| SMILES | CC/N=C/CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-2-18-14-13-17(19,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,19H,2,13H2,1H3/b18-14+ |
| InChIKey | NDQIRWRZFBJVEO-NBVRZTHBSA-N |
| XLogP | 3.40 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|