C24H36F3N5O6 — CID 168917197
tert-butyl N-[[(3S,3aS,6aR)-2-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate (PubChem CID 168917197) has the molecular formula C24H36F3N5O6 and a molecular weight of 547.58 g/mol. Its IUPAC name is tert-butyl N-[[(3S,3aS,6aR)-2-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3S,3aS,6aR)-2-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 168917197 |
| Molecular Formula | C24H36F3N5O6 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | tert-butyl N-[[(3S,3aS,6aR)-2-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC[C@H](NC(=O)C(F)(F)F)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)NN(C[C@@H]1CCNC1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H36F3N5O6/c1-5-16(29-21(36)24(25,26)27)20(35)31-11-13-7-6-8-15(13)17(31)19(34)30-32(22(37)38-23(2,3)4)12-14-9-10-28-18(14)33/h13-17H,5-12H2,1-4H3,(H,28,33)(H,29,36)(H,30,34)/t13-,14-,15-,16-,17-/m0/s1 |
| InChIKey | IKTOCGDSGPZDRJ-WOYTXXSLSA-N |
| XLogP | 1.48 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|