C26H34F2N4O6 — CID 168917327
tert-butyl N-[[(1R,2S,5S)-3-[2-(3,5-difluorophenoxy)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate (PubChem CID 168917327) has the molecular formula C26H34F2N4O6 and a molecular weight of 536.58 g/mol. Its IUPAC name is tert-butyl N-[[(1R,2S,5S)-3-[2-(3,5-difluorophenoxy)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1R,2S,5S)-3-[2-(3,5-difluorophenoxy)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 168917327 |
| Molecular Formula | C26H34F2N4O6 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | tert-butyl N-[[(1R,2S,5S)-3-[2-(3,5-difluorophenoxy)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C[C@@H]1CCNC1=O)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)COc1cc(F)cc(F)c1)C2(C)C |
| InChI | InChI=1S/C26H34F2N4O6/c1-25(2,3)38-24(36)32(11-14-6-7-29-22(14)34)30-23(35)21-20-18(26(20,4)5)12-31(21)19(33)13-37-17-9-15(27)8-16(28)10-17/h8-10,14,18,20-21H,6-7,11-13H2,1-5H3,(H,29,34)(H,30,35)/t14-,18-,20-,21-/m0/s1 |
| InChIKey | QYWLELOOJKVAKX-XNKDMPNBSA-N |
| XLogP | 2.23 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|