C19H8F6N2O3S — CID 168917604
(5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(5-ethynylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 168917604) has the molecular formula C19H8F6N2O3S and a molecular weight of 458.34 g/mol. Its IUPAC name is (5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(5-ethynylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(5-ethynylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 168917604 |
| Molecular Formula | C19H8F6N2O3S |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | (5E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[(5-ethynylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C#Cc1ccc(/C=C2\C(=O)NC(=S)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2=O)o1 |
| InChI | InChI=1S/C19H8F6N2O3S/c1-2-12-3-4-13(30-12)8-14-15(28)26-17(31)27(16(14)29)11-6-9(18(20,21)22)5-10(7-11)19(23,24)25/h1,3-8H,(H,26,28,31)/b14-8+ |
| InChIKey | IEIUVVQXWFJMGU-RIYZIHGNSA-N |
| XLogP | 4.13 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|