About (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten
(5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten (PubChem CID 168918393) has the molecular formula C11H16ClN2O2W-
and a molecular weight of 427.55 g/mol. Its IUPAC name is (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten.
Molecular Properties
| Compound Name | (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten |
| PubChem CID | 168918393 |
| Molecular Formula | C11H16ClN2O2W- |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten |
| SMILES | C1CC[N-]C1.COc1cc(CO)c(Cl)cn1.[W] |
| InChI | InChI=1S/C7H8ClNO2.C4H8N.W/c1-11-7-2-5(4-10)6(8)3-9-7;1-2-4-5-3-1;/h2-3,10H,4H2,1H3;1-4H2;/q;-1; |
| InChIKey | SSWMPFFTYQOGJZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten?
The IUPAC name of (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten (CID 168918393) is (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten.
What is the SMILES notation for (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten?
The canonical SMILES for (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten is C1CC[N-]C1.COc1cc(CO)c(Cl)cn1.[W].
What is the InChIKey of (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten?
The InChIKey is SSWMPFFTYQOGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO2.C4H8N.W/c1-11-7-2-5(4-10)6(8)3-9-7;1-2-4-5-3-1;/h2-3,10H,4H2,1H3;1-4H2;/q;-1;.
What are the key properties of (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten?
(5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten has a molecular weight of 427.55 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-methoxy-4-pyridinyl)methanol;pyrrolidin-1-ide;tungsten is sourced from PubChem (CID 168918393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).