C12H18ClNO2 — CID 114920735
[5-chloro-2-(3,3-dimethylbutoxy)-4-pyridinyl]methanol (PubChem CID 114920735) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is [5-chloro-2-(3,3-dimethylbutoxy)-4-pyridinyl]methanol.
| Compound Name | [5-chloro-2-(3,3-dimethylbutoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 114920735 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | [5-chloro-2-(3,3-dimethylbutoxy)-4-pyridinyl]methanol |
| SMILES | CC(C)(C)CCOc1cc(CO)c(Cl)cn1 |
| InChI | InChI=1S/C12H18ClNO2/c1-12(2,3)4-5-16-11-6-9(8-15)10(13)7-14-11/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | GYLBFRJYUZCBPR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |