C32H40F2N4O2S — CID 168919167
(3R)-3-[(4R)-2-amino-4-ethyl-6-oxo-4-[4-[(4S)-2,2,4-trimethyl-3,4-dihydrochromen-6-yl]butyl]-5H-pyrimidin-1-yl]-1,1-difluoro-2,3-dihydroindene-5-carbothioamide (PubChem CID 168919167) has the molecular formula C32H40F2N4O2S and a molecular weight of 582.76 g/mol. Its IUPAC name is (3R)-3-[(4R)-2-amino-4-ethyl-6-oxo-4-[4-[(4S)-2,2,4-trimethyl-3,4-dihydrochromen-6-yl]butyl]-5H-pyrimidin-1-yl]-1,1-difluoro-2,3-dihydroindene-5-carbothioamide.
| Compound Name | (3R)-3-[(4R)-2-amino-4-ethyl-6-oxo-4-[4-[(4S)-2,2,4-trimethyl-3,4-dihydrochromen-6-yl]butyl]-5H-pyrimidin-1-yl]-1,1-difluoro-2,3-dihydroindene-5-carbothioamide |
|---|---|
| PubChem CID | 168919167 |
| Molecular Formula | C32H40F2N4O2S |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | (3R)-3-[(4R)-2-amino-4-ethyl-6-oxo-4-[4-[(4S)-2,2,4-trimethyl-3,4-dihydrochromen-6-yl]butyl]-5H-pyrimidin-1-yl]-1,1-difluoro-2,3-dihydroindene-5-carbothioamide |
| SMILES | CC[C@@]1(CCCCc2ccc3c(c2)[C@@H](C)CC(C)(C)O3)CC(=O)N([C@@H]2CC(F)(F)c3ccc(C(N)=S)cc32)C(N)=N1 |
| InChI | InChI=1S/C32H40F2N4O2S/c1-5-31(13-7-6-8-20-9-12-26-22(14-20)19(2)16-30(3,4)40-26)18-27(39)38(29(36)37-31)25-17-32(33,34)24-11-10-21(28(35)41)15-23(24)25/h9-12,14-15,19,25H,5-8,13,16-18H2,1-4H3,(H2,35,41)(H2,36,37)/t19-,25+,31+/m0/s1 |
| InChIKey | MPTIUGZSMHTDFL-DDMAJYPWSA-N |
| XLogP | 6.63 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|