C14H18FNO2 — CID 168924079
1-(4-ethenyl-3-methoxyphenyl)-4-fluoro-2-(methylamino)butan-1-one (PubChem CID 168924079) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 1-(4-ethenyl-3-methoxyphenyl)-4-fluoro-2-(methylamino)butan-1-one.
| Compound Name | 1-(4-ethenyl-3-methoxyphenyl)-4-fluoro-2-(methylamino)butan-1-one |
|---|---|
| PubChem CID | 168924079 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(4-ethenyl-3-methoxyphenyl)-4-fluoro-2-(methylamino)butan-1-one |
| SMILES | C=Cc1ccc(C(=O)C(CCF)NC)cc1OC |
| InChI | InChI=1S/C14H18FNO2/c1-4-10-5-6-11(9-13(10)18-3)14(17)12(16-2)7-8-15/h4-6,9,12,16H,1,7-8H2,2-3H3 |
| InChIKey | VVJOEHXZICJLBZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |