C23H28F2N2O2 — CID 68636214
1,9-bis(4-fluorophenyl)-2,8-bis(methylamino)nonane-1,9-dione (PubChem CID 68636214) has the molecular formula C23H28F2N2O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1,9-bis(4-fluorophenyl)-2,8-bis(methylamino)nonane-1,9-dione.
| Compound Name | 1,9-bis(4-fluorophenyl)-2,8-bis(methylamino)nonane-1,9-dione |
|---|---|
| PubChem CID | 68636214 |
| Molecular Formula | C23H28F2N2O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1,9-bis(4-fluorophenyl)-2,8-bis(methylamino)nonane-1,9-dione |
| SMILES | CNC(CCCCCC(NC)C(=O)c1ccc(F)cc1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H28F2N2O2/c1-26-20(22(28)16-8-12-18(24)13-9-16)6-4-3-5-7-21(27-2)23(29)17-10-14-19(25)15-11-17/h8-15,20-21,26-27H,3-7H2,1-2H3 |
| InChIKey | XAQSZSKCNLQHOM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|