C17H27NOS — CID 168924111
2-(1-benzofuran-6-yl)-N-tert-butylsulfanyl-N-methylethanamine;ethane (PubChem CID 168924111) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is 2-(1-benzofuran-6-yl)-N-tert-butylsulfanyl-N-methylethanamine;ethane.
| Compound Name | 2-(1-benzofuran-6-yl)-N-tert-butylsulfanyl-N-methylethanamine;ethane |
|---|---|
| PubChem CID | 168924111 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-(1-benzofuran-6-yl)-N-tert-butylsulfanyl-N-methylethanamine;ethane |
| SMILES | CC.CN(CCc1ccc2ccoc2c1)SC(C)(C)C |
| InChI | InChI=1S/C15H21NOS.C2H6/c1-15(2,3)18-16(4)9-7-12-5-6-13-8-10-17-14(13)11-12;1-2/h5-6,8,10-11H,7,9H2,1-4H3;1-2H3 |
| InChIKey | SLFACVARFBVYPF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|