C13H14F3NO — CID 168924123
3-(1-benzofuran-6-yl)-N-ethyl-1,1,1-trifluoropropan-2-amine (PubChem CID 168924123) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-(1-benzofuran-6-yl)-N-ethyl-1,1,1-trifluoropropan-2-amine.
| Compound Name | 3-(1-benzofuran-6-yl)-N-ethyl-1,1,1-trifluoropropan-2-amine |
|---|---|
| PubChem CID | 168924123 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-(1-benzofuran-6-yl)-N-ethyl-1,1,1-trifluoropropan-2-amine |
| SMILES | CCNC(Cc1ccc2ccoc2c1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO/c1-2-17-12(13(14,15)16)8-9-3-4-10-5-6-18-11(10)7-9/h3-7,12,17H,2,8H2,1H3 |
| InChIKey | NAXREFIVTHFEPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |