C13H13F2NO2 — CID 166892538
1-(1-benzofuran-6-yl)-2-(ethylamino)-3,3-difluoropropan-1-one (PubChem CID 166892538) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-(1-benzofuran-6-yl)-2-(ethylamino)-3,3-difluoropropan-1-one.
| Compound Name | 1-(1-benzofuran-6-yl)-2-(ethylamino)-3,3-difluoropropan-1-one |
|---|---|
| PubChem CID | 166892538 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(1-benzofuran-6-yl)-2-(ethylamino)-3,3-difluoropropan-1-one |
| SMILES | CCNC(C(=O)c1ccc2ccoc2c1)C(F)F |
| InChI | InChI=1S/C13H13F2NO2/c1-2-16-11(13(14)15)12(17)9-4-3-8-5-6-18-10(8)7-9/h3-7,11,13,16H,2H2,1H3 |
| InChIKey | WEPPKABWGVBLTF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |