C14H19NO3 — CID 166892615
3-(1-benzofuran-6-yl)-2-(ethylamino)butane-1,3-diol (PubChem CID 166892615) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-(1-benzofuran-6-yl)-2-(ethylamino)butane-1,3-diol.
| Compound Name | 3-(1-benzofuran-6-yl)-2-(ethylamino)butane-1,3-diol |
|---|---|
| PubChem CID | 166892615 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-(1-benzofuran-6-yl)-2-(ethylamino)butane-1,3-diol |
| SMILES | CCNC(CO)C(C)(O)c1ccc2ccoc2c1 |
| InChI | InChI=1S/C14H19NO3/c1-3-15-13(9-16)14(2,17)11-5-4-10-6-7-18-12(10)8-11/h4-8,13,15-17H,3,9H2,1-2H3 |
| InChIKey | HMQVIDFDPLMMFJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |