C15H18Cl3NO2 — CID 166892759
3-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(ethylamino)-3-methylbutan-1-ol (PubChem CID 166892759) has the molecular formula C15H18Cl3NO2 and a molecular weight of 350.67 g/mol. Its IUPAC name is 3-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(ethylamino)-3-methylbutan-1-ol.
| Compound Name | 3-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(ethylamino)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 166892759 |
| Molecular Formula | C15H18Cl3NO2 |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 3-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(ethylamino)-3-methylbutan-1-ol |
| SMILES | CCNC(CO)C(C)(c1ccc2occc2c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H18Cl3NO2/c1-3-19-13(9-20)14(2,15(16,17)18)11-4-5-12-10(8-11)6-7-21-12/h4-8,13,19-20H,3,9H2,1-2H3 |
| InChIKey | WHMRQBXYSMTSKK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|