C16H22NORu — CID 168924316
2-(1-benzofuran-5-yl)-N-ethyl-2-methylpentan-1-amine;ruthenium(1+) (PubChem CID 168924316) has the molecular formula C16H22NORu and a molecular weight of 345.43 g/mol. Its IUPAC name is 2-(1-benzofuran-5-yl)-N-ethyl-2-methylpentan-1-amine;ruthenium(1+).
| Compound Name | 2-(1-benzofuran-5-yl)-N-ethyl-2-methylpentan-1-amine;ruthenium(1+) |
|---|---|
| PubChem CID | 168924316 |
| Molecular Formula | C16H22NORu |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-(1-benzofuran-5-yl)-N-ethyl-2-methylpentan-1-amine;ruthenium(1+) |
| SMILES | CCCC(C)([CH-]NCC)c1ccc2occc2c1.[Ru+] |
| InChI | InChI=1S/C16H22NO.Ru/c1-4-9-16(3,12-17-5-2)14-6-7-15-13(11-14)8-10-18-15;/h6-8,10-12,17H,4-5,9H2,1-3H3;/q-1;+1 |
| InChIKey | SPDMPCPVZVKMBQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|