C15H18ClNO — CID 168925902
2-(1-benzofuran-6-yl)-5-chloro-N-ethylpent-1-en-3-amine (PubChem CID 168925902) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is 2-(1-benzofuran-6-yl)-5-chloro-N-ethylpent-1-en-3-amine.
| Compound Name | 2-(1-benzofuran-6-yl)-5-chloro-N-ethylpent-1-en-3-amine |
|---|---|
| PubChem CID | 168925902 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-(1-benzofuran-6-yl)-5-chloro-N-ethylpent-1-en-3-amine |
| SMILES | C=C(c1ccc2ccoc2c1)C(CCCl)NCC |
| InChI | InChI=1S/C15H18ClNO/c1-3-17-14(6-8-16)11(2)13-5-4-12-7-9-18-15(12)10-13/h4-5,7,9-10,14,17H,2-3,6,8H2,1H3 |
| InChIKey | RANYEKVGHPTQQK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|