C24H24F3N5O2 — CID 168925017
4-[7-[(4-nitrophenyl)methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-6-(2,2,2-trifluoroethyl)quinazoline (PubChem CID 168925017) has the molecular formula C24H24F3N5O2 and a molecular weight of 471.48 g/mol. Its IUPAC name is 4-[7-[(4-nitrophenyl)methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-6-(2,2,2-trifluoroethyl)quinazoline.
| Compound Name | 4-[7-[(4-nitrophenyl)methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-6-(2,2,2-trifluoroethyl)quinazoline |
|---|---|
| PubChem CID | 168925017 |
| Molecular Formula | C24H24F3N5O2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 4-[7-[(4-nitrophenyl)methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-6-(2,2,2-trifluoroethyl)quinazoline |
| SMILES | O=[N+]([O-])c1ccc(CN2CCC3(CC2)CN(c2ncnc4ccc(CC(F)(F)F)cc24)C3)cc1 |
| InChI | InChI=1S/C24H24F3N5O2/c25-24(26,27)12-18-3-6-21-20(11-18)22(29-16-28-21)31-14-23(15-31)7-9-30(10-8-23)13-17-1-4-19(5-2-17)32(33)34/h1-6,11,16H,7-10,12-15H2 |
| InChIKey | FQORTLGBDBHINX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|