C14H19FN4 — CID 168925062
(E)-N'-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-methylbut-1-ene-1,4-diamine (PubChem CID 168925062) has the molecular formula C14H19FN4 and a molecular weight of 262.33 g/mol. Its IUPAC name is (E)-N'-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-methylbut-1-ene-1,4-diamine.
| Compound Name | (E)-N'-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-methylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 168925062 |
| Molecular Formula | C14H19FN4 |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (E)-N'-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-methylbut-1-ene-1,4-diamine |
| SMILES | C/C(=C\N)CCNCc1nc2c(F)cccc2n1C |
| InChI | InChI=1S/C14H19FN4/c1-10(8-16)6-7-17-9-13-18-14-11(15)4-3-5-12(14)19(13)2/h3-5,8,17H,6-7,9,16H2,1-2H3/b10-8+ |
| InChIKey | NWZOROYKMSFIKM-CSKARUKUSA-N |
| XLogP | 2.05 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|