C14H16FN5 — CID 168925054
N-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine (PubChem CID 168925054) has the molecular formula C14H16FN5 and a molecular weight of 273.31 g/mol. Its IUPAC name is N-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine.
| Compound Name | N-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 168925054 |
| Molecular Formula | C14H16FN5 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-[(4-fluoro-1-methylbenzimidazol-2-yl)methyl]-2-(1H-imidazol-5-yl)ethanamine |
| SMILES | Cn1c(CNCCc2cnc[nH]2)nc2c(F)cccc21 |
| InChI | InChI=1S/C14H16FN5/c1-20-12-4-2-3-11(15)14(12)19-13(20)8-16-6-5-10-7-17-9-18-10/h2-4,7,9,16H,5-6,8H2,1H3,(H,17,18) |
| InChIKey | MSNNOFXHVDEFIH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|