C15H13BrN2 — CID 168926629
6-bromo-4-(2-cyclobutylethynyl)isoquinolin-3-amine (PubChem CID 168926629) has the molecular formula C15H13BrN2 and a molecular weight of 301.19 g/mol. Its IUPAC name is 6-bromo-4-(2-cyclobutylethynyl)isoquinolin-3-amine.
| Compound Name | 6-bromo-4-(2-cyclobutylethynyl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 168926629 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 6-bromo-4-(2-cyclobutylethynyl)isoquinolin-3-amine |
| SMILES | Nc1ncc2ccc(Br)cc2c1C#CC1CCC1 |
| InChI | InChI=1S/C15H13BrN2/c16-12-6-5-11-9-18-15(17)13(14(11)8-12)7-4-10-2-1-3-10/h5-6,8-10H,1-3H2,(H2,17,18) |
| InChIKey | AFAZLJKRPHDYBE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|