C22H33BrN6S — CID 145005033
4-amino-N'-(2-sulfanylethyl)benzenecarboximidamide;6-bromoisoquinoline-3,4-diamine;ethane (PubChem CID 145005033) has the molecular formula C22H33BrN6S and a molecular weight of 493.52 g/mol. Its IUPAC name is 4-amino-N'-(2-sulfanylethyl)benzenecarboximidamide;6-bromoisoquinoline-3,4-diamine;ethane.
| Compound Name | 4-amino-N'-(2-sulfanylethyl)benzenecarboximidamide;6-bromoisoquinoline-3,4-diamine;ethane |
|---|---|
| PubChem CID | 145005033 |
| Molecular Formula | C22H33BrN6S |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 4-amino-N'-(2-sulfanylethyl)benzenecarboximidamide;6-bromoisoquinoline-3,4-diamine;ethane |
| SMILES | CC.CC.N/C(=N\CCS)c1ccc(N)cc1.Nc1ncc2ccc(Br)cc2c1N |
| InChI | InChI=1S/C9H8BrN3.C9H13N3S.2C2H6/c10-6-2-1-5-4-13-9(12)8(11)7(5)3-6;10-8-3-1-7(2-4-8)9(11)12-5-6-13;2*1-2/h1-4H,11H2,(H2,12,13);1-4,13H,5-6,10H2,(H2,11,12);2*1-2H3 |
| InChIKey | RLYSRGGHIWPZFD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|