C19H20BrN5O — CID 118687531
6-bromo-4-[[4-[2-(dimethylamino)ethoxy]phenyl]diazenyl]isoquinolin-3-amine (PubChem CID 118687531) has the molecular formula C19H20BrN5O and a molecular weight of 414.31 g/mol. Its IUPAC name is 6-bromo-4-[[4-[2-(dimethylamino)ethoxy]phenyl]diazenyl]isoquinolin-3-amine.
| Compound Name | 6-bromo-4-[[4-[2-(dimethylamino)ethoxy]phenyl]diazenyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 118687531 |
| Molecular Formula | C19H20BrN5O |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 6-bromo-4-[[4-[2-(dimethylamino)ethoxy]phenyl]diazenyl]isoquinolin-3-amine |
| SMILES | CN(C)CCOc1ccc(/N=N/c2c(N)ncc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C19H20BrN5O/c1-25(2)9-10-26-16-7-5-15(6-8-16)23-24-18-17-11-14(20)4-3-13(17)12-22-19(18)21/h3-8,11-12H,9-10H2,1-2H3,(H2,21,22)/b24-23+ |
| InChIKey | ASWPYJUIRRQKLD-WCWDXBQESA-N |
| XLogP | 4.94 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|