C20H22N4O2 — CID 91316983
N,N-dimethyl-2-[4-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]phenoxy]ethanamine (PubChem CID 91316983) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 91316983 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N,N-dimethyl-2-[4-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]phenoxy]ethanamine |
| SMILES | CN(C)CCOc1ccc(C/N=N/c2ccc(-c3cnco3)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-24(2)11-12-25-19-9-3-16(4-10-19)13-22-23-18-7-5-17(6-8-18)20-14-21-15-26-20/h3-10,14-15H,11-13H2,1-2H3/b23-22+ |
| InChIKey | SLNFNMPKIUNSKP-GHVJWSGMSA-N |
| XLogP | 4.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|