C25H22BrN5O — CID 158391443
4-[3-[4-[(3-amino-6-bromoisoquinolin-4-yl)diazenyl]phenyl]-3-iminopropyl]-2-methylphenol (PubChem CID 158391443) has the molecular formula C25H22BrN5O and a molecular weight of 488.39 g/mol. Its IUPAC name is 4-[3-[4-[(3-amino-6-bromoisoquinolin-4-yl)diazenyl]phenyl]-3-iminopropyl]-2-methylphenol.
| Compound Name | 4-[3-[4-[(3-amino-6-bromoisoquinolin-4-yl)diazenyl]phenyl]-3-iminopropyl]-2-methylphenol |
|---|---|
| PubChem CID | 158391443 |
| Molecular Formula | C25H22BrN5O |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 4-[3-[4-[(3-amino-6-bromoisoquinolin-4-yl)diazenyl]phenyl]-3-iminopropyl]-2-methylphenol |
| SMILES | [H]/N=C(\CCc1ccc(O)c(C)c1)c1ccc(/N=N/c2c(N)ncc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C25H22BrN5O/c1-15-12-16(3-11-23(15)32)2-10-22(27)17-5-8-20(9-6-17)30-31-24-21-13-19(26)7-4-18(21)14-29-25(24)28/h3-9,11-14,27,32H,2,10H2,1H3,(H2,28,29)/b27-22+,31-30+ |
| InChIKey | OSNUESJNGNVSSZ-YRPQUOBASA-N |
| XLogP | 7.01 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|