C17H16N6O — CID 162173945
2-[6-[(3-amino-6-methylisoquinolin-4-yl)diazenyl]-3-pyridinyl]-2-iminoethanol (PubChem CID 162173945) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[6-[(3-amino-6-methylisoquinolin-4-yl)diazenyl]-3-pyridinyl]-2-iminoethanol.
| Compound Name | 2-[6-[(3-amino-6-methylisoquinolin-4-yl)diazenyl]-3-pyridinyl]-2-iminoethanol |
|---|---|
| PubChem CID | 162173945 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[6-[(3-amino-6-methylisoquinolin-4-yl)diazenyl]-3-pyridinyl]-2-iminoethanol |
| SMILES | [H]/N=C(\CO)c1ccc(/N=N/c2c(N)ncc3ccc(C)cc23)nc1 |
| InChI | InChI=1S/C17H16N6O/c1-10-2-3-11-7-21-17(19)16(13(11)6-10)23-22-15-5-4-12(8-20-15)14(18)9-24/h2-8,18,24H,9H2,1H3,(H2,19,21)/b18-14+,23-22+ |
| InChIKey | DAUPVVQCXKROFJ-WWHMVCCTSA-N |
| XLogP | 3.30 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|