C19H18N6 — CID 129262520
4-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]diazenyl]-6-methylisoquinolin-3-amine (PubChem CID 129262520) has the molecular formula C19H18N6 and a molecular weight of 330.40 g/mol. Its IUPAC name is 4-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]diazenyl]-6-methylisoquinolin-3-amine.
| Compound Name | 4-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]diazenyl]-6-methylisoquinolin-3-amine |
|---|---|
| PubChem CID | 129262520 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]diazenyl]-6-methylisoquinolin-3-amine |
| SMILES | Cc1ccc2cnc(N)c(/N=N/c3ccc(C4=NCCN4)cc3)c2c1 |
| InChI | InChI=1S/C19H18N6/c1-12-2-3-14-11-23-18(20)17(16(14)10-12)25-24-15-6-4-13(5-7-15)19-21-8-9-22-19/h2-7,10-11H,8-9H2,1H3,(H2,20,23)(H,21,22)/b25-24+ |
| InChIKey | MMUIMGBXLXUJJL-OCOZRVBESA-N |
| XLogP | 3.89 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|