C17H16N4 — CID 142291210
3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-4-methylpyridin-2-amine (PubChem CID 142291210) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-4-methylpyridin-2-amine.
| Compound Name | 3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 142291210 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N)c1C#Cc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C17H16N4/c1-12-8-9-19-16(18)15(12)7-4-13-2-5-14(6-3-13)17-20-10-11-21-17/h2-3,5-6,8-9H,10-11H2,1H3,(H2,18,19)(H,20,21) |
| InChIKey | VZJKWOIVSCNMGI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|