C24H23N3 — CID 158082898
4-[2-[4-(3,3-dimethyl-2,4-dihydropyrrol-5-yl)phenyl]ethynyl]-8-methylisoquinolin-3-amine (PubChem CID 158082898) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-[2-[4-(3,3-dimethyl-2,4-dihydropyrrol-5-yl)phenyl]ethynyl]-8-methylisoquinolin-3-amine.
| Compound Name | 4-[2-[4-(3,3-dimethyl-2,4-dihydropyrrol-5-yl)phenyl]ethynyl]-8-methylisoquinolin-3-amine |
|---|---|
| PubChem CID | 158082898 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-[2-[4-(3,3-dimethyl-2,4-dihydropyrrol-5-yl)phenyl]ethynyl]-8-methylisoquinolin-3-amine |
| SMILES | Cc1cccc2c(C#Cc3ccc(C4=NCC(C)(C)C4)cc3)c(N)ncc12 |
| InChI | InChI=1S/C24H23N3/c1-16-5-4-6-19-20(23(25)26-14-21(16)19)12-9-17-7-10-18(11-8-17)22-13-24(2,3)15-27-22/h4-8,10-11,14H,13,15H2,1-3H3,(H2,25,26) |
| InChIKey | HHEIIUSGWZTATB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|