C24H23ClN4S — CID 162203038
6-chloro-4-[2-[4-(5-cyclopropyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine;methanethiol (PubChem CID 162203038) has the molecular formula C24H23ClN4S and a molecular weight of 435.00 g/mol. Its IUPAC name is 6-chloro-4-[2-[4-(5-cyclopropyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine;methanethiol.
| Compound Name | 6-chloro-4-[2-[4-(5-cyclopropyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine;methanethiol |
|---|---|
| PubChem CID | 162203038 |
| Molecular Formula | C24H23ClN4S |
| Molecular Weight | 435.00 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 6-chloro-4-[2-[4-(5-cyclopropyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine;methanethiol |
| SMILES | CS.Nc1ncc2ccc(Cl)cc2c1C#Cc1ccc(C2=NCC(C3CC3)N2)cc1 |
| InChI | InChI=1S/C23H19ClN4.CH4S/c24-18-9-8-17-12-26-22(25)19(20(17)11-18)10-3-14-1-4-16(5-2-14)23-27-13-21(28-23)15-6-7-15;1-2/h1-2,4-5,8-9,11-12,15,21H,6-7,13H2,(H2,25,26)(H,27,28);2H,1H3 |
| InChIKey | ZRVIGZFIPXSKRA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.00 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|