C30H33ClN6O3 — CID 134276891
tert-butyl N-[N'-[4-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]cyclohexyl]carbamimidoyl]carbamate (PubChem CID 134276891) has the molecular formula C30H33ClN6O3 and a molecular weight of 561.09 g/mol. Its IUPAC name is tert-butyl N-[N'-[4-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]cyclohexyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[4-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]cyclohexyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 134276891 |
| Molecular Formula | C30H33ClN6O3 |
| Molecular Weight | 561.09 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | tert-butyl N-[N'-[4-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]cyclohexyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(N)=N/C1CCC(NC(=O)c2ccc(C#Cc3c(N)ncc4ccc(Cl)cc34)cc2)CC1 |
| InChI | InChI=1S/C30H33ClN6O3/c1-30(2,3)40-29(39)37-28(33)36-23-13-11-22(12-14-23)35-27(38)19-7-4-18(5-8-19)6-15-24-25-16-21(31)10-9-20(25)17-34-26(24)32/h4-5,7-10,16-17,22-23H,11-14H2,1-3H3,(H2,32,34)(H,35,38)(H3,33,36,37,39) |
| InChIKey | CAQZPUNGUOOQGE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 144.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.09 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|