C29H33ClN4O3 — CID 167104026
4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclohexyl]benzamide (PubChem CID 167104026) has the molecular formula C29H33ClN4O3 and a molecular weight of 521.06 g/mol. Its IUPAC name is 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclohexyl]benzamide.
| Compound Name | 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 167104026 |
| Molecular Formula | C29H33ClN4O3 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]cyclohexyl]benzamide |
| SMILES | CC(C)(C)OC(O)NC1CCC(NC(=O)c2ccc(C#Cc3c(N)ncc4ccc(Cl)cc34)cc2)CC1 |
| InChI | InChI=1S/C29H33ClN4O3/c1-29(2,3)37-28(36)34-23-13-11-22(12-14-23)33-27(35)19-7-4-18(5-8-19)6-15-24-25-16-21(30)10-9-20(25)17-32-26(24)31/h4-5,7-10,16-17,22-23,28,34,36H,11-14H2,1-3H3,(H2,31,32)(H,33,35) |
| InChIKey | SNJMYKNWKKUFFO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|