C28H29ClN4O — CID 134264280
[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone (PubChem CID 134264280) has the molecular formula C28H29ClN4O and a molecular weight of 473.02 g/mol. Its IUPAC name is [4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 134264280 |
| Molecular Formula | C28H29ClN4O |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
| SMILES | Nc1ncc2ccc(Cl)cc2c1C#Cc1ccc(C(=O)N2CCC(N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C28H29ClN4O/c29-23-10-9-22-19-31-27(30)25(26(22)18-23)11-6-20-4-7-21(8-5-20)28(34)33-16-12-24(13-17-33)32-14-2-1-3-15-32/h4-5,7-10,18-19,24H,1-3,12-17H2,(H2,30,31) |
| InChIKey | MJIHYVCLJYQLTI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|