C22H19ClN2O — CID 159955526
1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]pentan-1-one (PubChem CID 159955526) has the molecular formula C22H19ClN2O and a molecular weight of 362.86 g/mol. Its IUPAC name is 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]pentan-1-one.
| Compound Name | 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 159955526 |
| Molecular Formula | C22H19ClN2O |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]pentan-1-one |
| SMILES | CCCCC(=O)c1ccc(C#Cc2c(N)ncc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C22H19ClN2O/c1-2-3-4-21(26)16-8-5-15(6-9-16)7-12-19-20-13-18(23)11-10-17(20)14-25-22(19)24/h5-6,8-11,13-14H,2-4H2,1H3,(H2,24,25) |
| InChIKey | FJVBOAZRZJWNAY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|