C23H23ClN4O2 — CID 134264266
3-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylamino)-2-hydroxypropyl]benzamide (PubChem CID 134264266) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 3-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylamino)-2-hydroxypropyl]benzamide.
| Compound Name | 3-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylamino)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 134264266 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 3-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylamino)-2-hydroxypropyl]benzamide |
| SMILES | CN(C)CC(O)CNC(=O)c1cccc(C#Cc2c(N)ncc3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C23H23ClN4O2/c1-28(2)14-19(29)13-27-23(30)16-5-3-4-15(10-16)6-9-20-21-11-18(24)8-7-17(21)12-26-22(20)25/h3-5,7-8,10-12,19,29H,13-14H2,1-2H3,(H2,25,26)(H,27,30) |
| InChIKey | URKDKXXBZXRMCU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|