C26H29ClN4O4S — CID 134277026
4-[2-[6-chloro-3-(methanesulfonamido)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide (PubChem CID 134277026) has the molecular formula C26H29ClN4O4S and a molecular weight of 529.06 g/mol. Its IUPAC name is 4-[2-[6-chloro-3-(methanesulfonamido)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[2-[6-chloro-3-(methanesulfonamido)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 134277026 |
| Molecular Formula | C26H29ClN4O4S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 4-[2-[6-chloro-3-(methanesulfonamido)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
| SMILES | CCN(CC)CC(O)CNC(=O)c1ccc(C#Cc2c(NS(C)(=O)=O)ncc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C26H29ClN4O4S/c1-4-31(5-2)17-22(32)16-29-26(33)19-9-6-18(7-10-19)8-13-23-24-14-21(27)12-11-20(24)15-28-25(23)30-36(3,34)35/h6-7,9-12,14-15,22,32H,4-5,16-17H2,1-3H3,(H,28,30)(H,29,33) |
| InChIKey | HYPTUBJSWOGUHB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|