C29H33ClN4O2 — CID 134277019
4-[2-[6-chloro-3-(cyclopropylmethylamino)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide (PubChem CID 134277019) has the molecular formula C29H33ClN4O2 and a molecular weight of 505.06 g/mol. Its IUPAC name is 4-[2-[6-chloro-3-(cyclopropylmethylamino)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[2-[6-chloro-3-(cyclopropylmethylamino)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 134277019 |
| Molecular Formula | C29H33ClN4O2 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-[2-[6-chloro-3-(cyclopropylmethylamino)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
| SMILES | CCN(CC)CC(O)CNC(=O)c1ccc(C#Cc2c(NCC3CC3)ncc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C29H33ClN4O2/c1-3-34(4-2)19-25(35)18-33-29(36)22-10-7-20(8-11-22)9-14-26-27-15-24(30)13-12-23(27)17-32-28(26)31-16-21-5-6-21/h7-8,10-13,15,17,21,25,35H,3-6,16,18-19H2,1-2H3,(H,31,32)(H,33,36) |
| InChIKey | MIYJQAKKSKZXBJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|